C14H16FNO4S — CID 80549334
4-fluoro-3-(2-oxo-2-piperidin-1-ylethyl)sulfinylbenzoic acid (PubChem CID 80549334) has the molecular formula C14H16FNO4S and a molecular weight of 313.35 g/mol. Its IUPAC name is 4-fluoro-3-(2-oxo-2-piperidin-1-ylethyl)sulfinylbenzoic acid.
| Compound Name | 4-fluoro-3-(2-oxo-2-piperidin-1-ylethyl)sulfinylbenzoic acid |
|---|---|
| PubChem CID | 80549334 |
| Molecular Formula | C14H16FNO4S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 4-fluoro-3-(2-oxo-2-piperidin-1-ylethyl)sulfinylbenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(S(=O)CC(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C14H16FNO4S/c15-11-5-4-10(14(18)19)8-12(11)21(20)9-13(17)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7,9H2,(H,18,19) |
| InChIKey | WWELGBYVJLQGAQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |