C15H29NO5S — CID 106729052
tert-butyl 4-hydroxy-3-(2-propylsulfonylethyl)piperidine-1-carboxylate (PubChem CID 106729052) has the molecular formula C15H29NO5S and a molecular weight of 335.47 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-3-(2-propylsulfonylethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-3-(2-propylsulfonylethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 106729052 |
| Molecular Formula | C15H29NO5S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | tert-butyl 4-hydroxy-3-(2-propylsulfonylethyl)piperidine-1-carboxylate |
| SMILES | CCCS(=O)(=O)CCC1CN(C(=O)OC(C)(C)C)CCC1O |
| InChI | InChI=1S/C15H29NO5S/c1-5-9-22(19,20)10-7-12-11-16(8-6-13(12)17)14(18)21-15(2,3)4/h12-13,17H,5-11H2,1-4H3 |
| InChIKey | PLXXHCRQFGNDEY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |