C14H25NO5 — CID 156745703
tert-butyl 4-(2-ethoxy-2-oxoethyl)-3-hydroxypiperidine-1-carboxylate (PubChem CID 156745703) has the molecular formula C14H25NO5 and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl 4-(2-ethoxy-2-oxoethyl)-3-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-ethoxy-2-oxoethyl)-3-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 156745703 |
| Molecular Formula | C14H25NO5 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | tert-butyl 4-(2-ethoxy-2-oxoethyl)-3-hydroxypiperidine-1-carboxylate |
| SMILES | CCOC(=O)CC1CCN(C(=O)OC(C)(C)C)CC1O |
| InChI | InChI=1S/C14H25NO5/c1-5-19-12(17)8-10-6-7-15(9-11(10)16)13(18)20-14(2,3)4/h10-11,16H,5-9H2,1-4H3 |
| InChIKey | GTKJYCRYEPSSEH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |