C15H31NO4 — CID 145438130
tert-butyl 3-methylpyrrolidine-1-carboxylate;ethane;ethyl formate (PubChem CID 145438130) has the molecular formula C15H31NO4 and a molecular weight of 289.42 g/mol. Its IUPAC name is tert-butyl 3-methylpyrrolidine-1-carboxylate;ethane;ethyl formate.
| Compound Name | tert-butyl 3-methylpyrrolidine-1-carboxylate;ethane;ethyl formate |
|---|---|
| PubChem CID | 145438130 |
| Molecular Formula | C15H31NO4 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | tert-butyl 3-methylpyrrolidine-1-carboxylate;ethane;ethyl formate |
| SMILES | CC.CC1CCN(C(=O)OC(C)(C)C)C1.CCOC=O |
| InChI | InChI=1S/C10H19NO2.C3H6O2.C2H6/c1-8-5-6-11(7-8)9(12)13-10(2,3)4;1-2-5-3-4;1-2/h8H,5-7H2,1-4H3;3H,2H2,1H3;1-2H3 |
| InChIKey | JMELYWILXJAUOC-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|