C12H27NO2S — CID 106729640
N,4-dimethyl-2-(2-propylsulfonylethyl)pentan-1-amine (PubChem CID 106729640) has the molecular formula C12H27NO2S and a molecular weight of 249.42 g/mol. Its IUPAC name is N,4-dimethyl-2-(2-propylsulfonylethyl)pentan-1-amine.
| Compound Name | N,4-dimethyl-2-(2-propylsulfonylethyl)pentan-1-amine |
|---|---|
| PubChem CID | 106729640 |
| Molecular Formula | C12H27NO2S |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N,4-dimethyl-2-(2-propylsulfonylethyl)pentan-1-amine |
| SMILES | CCCS(=O)(=O)CCC(CNC)CC(C)C |
| InChI | InChI=1S/C12H27NO2S/c1-5-7-16(14,15)8-6-12(10-13-4)9-11(2)3/h11-13H,5-10H2,1-4H3 |
| InChIKey | UXNZGWBPJMQUBE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |