C16H33NO2S — CID 106729852
N-[[1-(2-tert-butylsulfonylethyl)cyclohexyl]methyl]propan-2-amine (PubChem CID 106729852) has the molecular formula C16H33NO2S and a molecular weight of 303.51 g/mol. Its IUPAC name is N-[[1-(2-tert-butylsulfonylethyl)cyclohexyl]methyl]propan-2-amine.
| Compound Name | N-[[1-(2-tert-butylsulfonylethyl)cyclohexyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 106729852 |
| Molecular Formula | C16H33NO2S |
| Molecular Weight | 303.51 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-[[1-(2-tert-butylsulfonylethyl)cyclohexyl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1(CCS(=O)(=O)C(C)(C)C)CCCCC1 |
| InChI | InChI=1S/C16H33NO2S/c1-14(2)17-13-16(9-7-6-8-10-16)11-12-20(18,19)15(3,4)5/h14,17H,6-13H2,1-5H3 |
| InChIKey | NHRLWZKPPABHCS-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.51 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |