C15H31NO3S — CID 106730407
N-[[3-(2-tert-butylsulfonylethyl)-2-methyloxolan-3-yl]methyl]propan-2-amine (PubChem CID 106730407) has the molecular formula C15H31NO3S and a molecular weight of 305.48 g/mol. Its IUPAC name is N-[[3-(2-tert-butylsulfonylethyl)-2-methyloxolan-3-yl]methyl]propan-2-amine.
| Compound Name | N-[[3-(2-tert-butylsulfonylethyl)-2-methyloxolan-3-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 106730407 |
| Molecular Formula | C15H31NO3S |
| Molecular Weight | 305.48 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | N-[[3-(2-tert-butylsulfonylethyl)-2-methyloxolan-3-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1(CCS(=O)(=O)C(C)(C)C)CCOC1C |
| InChI | InChI=1S/C15H31NO3S/c1-12(2)16-11-15(7-9-19-13(15)3)8-10-20(17,18)14(4,5)6/h12-13,16H,7-11H2,1-6H3 |
| InChIKey | UMGLSSGUIWIOHL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |