C11H23NO3S — CID 106730398
[2-methyl-3-(2-propan-2-ylsulfonylethyl)oxolan-3-yl]methanamine (PubChem CID 106730398) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is [2-methyl-3-(2-propan-2-ylsulfonylethyl)oxolan-3-yl]methanamine.
| Compound Name | [2-methyl-3-(2-propan-2-ylsulfonylethyl)oxolan-3-yl]methanamine |
|---|---|
| PubChem CID | 106730398 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | [2-methyl-3-(2-propan-2-ylsulfonylethyl)oxolan-3-yl]methanamine |
| SMILES | CC1OCCC1(CN)CCS(=O)(=O)C(C)C |
| InChI | InChI=1S/C11H23NO3S/c1-9(2)16(13,14)7-5-11(8-12)4-6-15-10(11)3/h9-10H,4-8,12H2,1-3H3 |
| InChIKey | PLPQQCJNHYSAFJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |