C10H21NO3S — CID 114534101
[3-(2-ethylsulfonylethyl)-2-methyloxolan-3-yl]methanamine (PubChem CID 114534101) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is [3-(2-ethylsulfonylethyl)-2-methyloxolan-3-yl]methanamine.
| Compound Name | [3-(2-ethylsulfonylethyl)-2-methyloxolan-3-yl]methanamine |
|---|---|
| PubChem CID | 114534101 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | [3-(2-ethylsulfonylethyl)-2-methyloxolan-3-yl]methanamine |
| SMILES | CCS(=O)(=O)CCC1(CN)CCOC1C |
| InChI | InChI=1S/C10H21NO3S/c1-3-15(12,13)7-5-10(8-11)4-6-14-9(10)2/h9H,3-8,11H2,1-2H3 |
| InChIKey | DXNCWKAFVPHQIQ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |