C17H29NO2S — CID 106730104
2-(2-methylphenyl)-4-propan-2-ylsulfonyl-N-propylbutan-1-amine (PubChem CID 106730104) has the molecular formula C17H29NO2S and a molecular weight of 311.49 g/mol. Its IUPAC name is 2-(2-methylphenyl)-4-propan-2-ylsulfonyl-N-propylbutan-1-amine.
| Compound Name | 2-(2-methylphenyl)-4-propan-2-ylsulfonyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 106730104 |
| Molecular Formula | C17H29NO2S |
| Molecular Weight | 311.49 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-(2-methylphenyl)-4-propan-2-ylsulfonyl-N-propylbutan-1-amine |
| SMILES | CCCNCC(CCS(=O)(=O)C(C)C)c1ccccc1C |
| InChI | InChI=1S/C17H29NO2S/c1-5-11-18-13-16(10-12-21(19,20)14(2)3)17-9-7-6-8-15(17)4/h6-9,14,16,18H,5,10-13H2,1-4H3 |
| InChIKey | WPGUNNIOKXNHHC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|