C16H33NO2S — CID 106730376
N-tert-butyl-2-cyclopentyl-4-propan-2-ylsulfonylbutan-1-amine (PubChem CID 106730376) has the molecular formula C16H33NO2S and a molecular weight of 303.51 g/mol. Its IUPAC name is N-tert-butyl-2-cyclopentyl-4-propan-2-ylsulfonylbutan-1-amine.
| Compound Name | N-tert-butyl-2-cyclopentyl-4-propan-2-ylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 106730376 |
| Molecular Formula | C16H33NO2S |
| Molecular Weight | 303.51 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-tert-butyl-2-cyclopentyl-4-propan-2-ylsulfonylbutan-1-amine |
| SMILES | CC(C)S(=O)(=O)CCC(CNC(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C16H33NO2S/c1-13(2)20(18,19)11-10-15(12-17-16(3,4)5)14-8-6-7-9-14/h13-15,17H,6-12H2,1-5H3 |
| InChIKey | ADBCZGHEYXYASN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |