C17H35N — CID 112570105
N-tert-butyl-2-cyclopentyl-5,5-dimethylhexan-1-amine (PubChem CID 112570105) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is N-tert-butyl-2-cyclopentyl-5,5-dimethylhexan-1-amine.
| Compound Name | N-tert-butyl-2-cyclopentyl-5,5-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 112570105 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | N-tert-butyl-2-cyclopentyl-5,5-dimethylhexan-1-amine |
| SMILES | CC(C)(C)CCC(CNC(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C17H35N/c1-16(2,3)12-11-15(13-18-17(4,5)6)14-9-7-8-10-14/h14-15,18H,7-13H2,1-6H3 |
| InChIKey | MLJVVQPKNSYOPK-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |