C16H33N — CID 112569928
2-cyclopentyl-5,5-dimethyl-N-propylhexan-1-amine (PubChem CID 112569928) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is 2-cyclopentyl-5,5-dimethyl-N-propylhexan-1-amine.
| Compound Name | 2-cyclopentyl-5,5-dimethyl-N-propylhexan-1-amine |
|---|---|
| PubChem CID | 112569928 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | 2-cyclopentyl-5,5-dimethyl-N-propylhexan-1-amine |
| SMILES | CCCNCC(CCC(C)(C)C)C1CCCC1 |
| InChI | InChI=1S/C16H33N/c1-5-12-17-13-15(10-11-16(2,3)4)14-8-6-7-9-14/h14-15,17H,5-13H2,1-4H3 |
| InChIKey | ABOPTRYJYXETRP-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|