C10H22ClNO2S — CID 106731302
1-chloro-N,2-dimethyl-N-(2-propan-2-ylsulfonylethyl)propan-2-amine (PubChem CID 106731302) has the molecular formula C10H22ClNO2S and a molecular weight of 255.81 g/mol. Its IUPAC name is 1-chloro-N,2-dimethyl-N-(2-propan-2-ylsulfonylethyl)propan-2-amine.
| Compound Name | 1-chloro-N,2-dimethyl-N-(2-propan-2-ylsulfonylethyl)propan-2-amine |
|---|---|
| PubChem CID | 106731302 |
| Molecular Formula | C10H22ClNO2S |
| Molecular Weight | 255.81 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 1-chloro-N,2-dimethyl-N-(2-propan-2-ylsulfonylethyl)propan-2-amine |
| SMILES | CC(C)S(=O)(=O)CCN(C)C(C)(C)CCl |
| InChI | InChI=1S/C10H22ClNO2S/c1-9(2)15(13,14)7-6-12(5)10(3,4)8-11/h9H,6-8H2,1-5H3 |
| InChIKey | YPYLUTFSJRAMOL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.81 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|