C19H23ClFNO2S — CID 166188270
N-[(4-chlorophenyl)-(4-fluorophenyl)methyl]-N-methyl-2-propan-2-ylsulfonylethanamine (PubChem CID 166188270) has the molecular formula C19H23ClFNO2S and a molecular weight of 383.92 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-(4-fluorophenyl)methyl]-N-methyl-2-propan-2-ylsulfonylethanamine.
| Compound Name | N-[(4-chlorophenyl)-(4-fluorophenyl)methyl]-N-methyl-2-propan-2-ylsulfonylethanamine |
|---|---|
| PubChem CID | 166188270 |
| Molecular Formula | C19H23ClFNO2S |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-[(4-chlorophenyl)-(4-fluorophenyl)methyl]-N-methyl-2-propan-2-ylsulfonylethanamine |
| SMILES | CC(C)S(=O)(=O)CCN(C)C(c1ccc(F)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClFNO2S/c1-14(2)25(23,24)13-12-22(3)19(15-4-8-17(20)9-5-15)16-6-10-18(21)11-7-16/h4-11,14,19H,12-13H2,1-3H3 |
| InChIKey | NMHJTLJVAZRIGN-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |