C14H19Cl2FO2S — CID 106734867
1-[1-chloro-2-(chloromethyl)-4-propan-2-ylsulfonylbutan-2-yl]-4-fluorobenzene (PubChem CID 106734867) has the molecular formula C14H19Cl2FO2S and a molecular weight of 341.28 g/mol. Its IUPAC name is 1-[1-chloro-2-(chloromethyl)-4-propan-2-ylsulfonylbutan-2-yl]-4-fluorobenzene.
| Compound Name | 1-[1-chloro-2-(chloromethyl)-4-propan-2-ylsulfonylbutan-2-yl]-4-fluorobenzene |
|---|---|
| PubChem CID | 106734867 |
| Molecular Formula | C14H19Cl2FO2S |
| Molecular Weight | 341.28 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 1-[1-chloro-2-(chloromethyl)-4-propan-2-ylsulfonylbutan-2-yl]-4-fluorobenzene |
| SMILES | CC(C)S(=O)(=O)CCC(CCl)(CCl)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H19Cl2FO2S/c1-11(2)20(18,19)8-7-14(9-15,10-16)12-3-5-13(17)6-4-12/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | IGNHABDDXJLTFV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.28 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|