C16H24Cl2O2S — CID 106734859
1-[4-tert-butylsulfonyl-1-chloro-2-(chloromethyl)butan-2-yl]-4-methylbenzene (PubChem CID 106734859) has the molecular formula C16H24Cl2O2S and a molecular weight of 351.34 g/mol. Its IUPAC name is 1-[4-tert-butylsulfonyl-1-chloro-2-(chloromethyl)butan-2-yl]-4-methylbenzene.
| Compound Name | 1-[4-tert-butylsulfonyl-1-chloro-2-(chloromethyl)butan-2-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 106734859 |
| Molecular Formula | C16H24Cl2O2S |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 1-[4-tert-butylsulfonyl-1-chloro-2-(chloromethyl)butan-2-yl]-4-methylbenzene |
| SMILES | Cc1ccc(C(CCl)(CCl)CCS(=O)(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24Cl2O2S/c1-13-5-7-14(8-6-13)16(11-17,12-18)9-10-21(19,20)15(2,3)4/h5-8H,9-12H2,1-4H3 |
| InChIKey | XMZWIIBQJFDFSK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|