C15H21Cl3O2S — CID 106734877
1-[4-tert-butylsulfonyl-1-chloro-2-(chloromethyl)butan-2-yl]-2-chlorobenzene (PubChem CID 106734877) has the molecular formula C15H21Cl3O2S and a molecular weight of 371.76 g/mol. Its IUPAC name is 1-[4-tert-butylsulfonyl-1-chloro-2-(chloromethyl)butan-2-yl]-2-chlorobenzene.
| Compound Name | 1-[4-tert-butylsulfonyl-1-chloro-2-(chloromethyl)butan-2-yl]-2-chlorobenzene |
|---|---|
| PubChem CID | 106734877 |
| Molecular Formula | C15H21Cl3O2S |
| Molecular Weight | 371.76 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 1-[4-tert-butylsulfonyl-1-chloro-2-(chloromethyl)butan-2-yl]-2-chlorobenzene |
| SMILES | CC(C)(C)S(=O)(=O)CCC(CCl)(CCl)c1ccccc1Cl |
| InChI | InChI=1S/C15H21Cl3O2S/c1-14(2,3)21(19,20)9-8-15(10-16,11-17)12-6-4-5-7-13(12)18/h4-7H,8-11H2,1-3H3 |
| InChIKey | WKUAOMGRDVIQIK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.76 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|