C14H19Cl3O — CID 79452898
1-chloro-2-[1-chloro-2-(chloromethyl)-4-propan-2-yloxybutan-2-yl]benzene (PubChem CID 79452898) has the molecular formula C14H19Cl3O and a molecular weight of 309.66 g/mol. Its IUPAC name is 1-chloro-2-[1-chloro-2-(chloromethyl)-4-propan-2-yloxybutan-2-yl]benzene.
| Compound Name | 1-chloro-2-[1-chloro-2-(chloromethyl)-4-propan-2-yloxybutan-2-yl]benzene |
|---|---|
| PubChem CID | 79452898 |
| Molecular Formula | C14H19Cl3O |
| Molecular Weight | 309.66 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | 1-chloro-2-[1-chloro-2-(chloromethyl)-4-propan-2-yloxybutan-2-yl]benzene |
| SMILES | CC(C)OCCC(CCl)(CCl)c1ccccc1Cl |
| InChI | InChI=1S/C14H19Cl3O/c1-11(2)18-8-7-14(9-15,10-16)12-5-3-4-6-13(12)17/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | RPMFCNKEWLHXBN-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.66 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|