C14H20Br2O2S — CID 79455970
1-[1-bromo-2-(bromomethyl)-4-ethylsulfonylbutan-2-yl]-4-methylbenzene (PubChem CID 79455970) has the molecular formula C14H20Br2O2S and a molecular weight of 412.19 g/mol. Its IUPAC name is 1-[1-bromo-2-(bromomethyl)-4-ethylsulfonylbutan-2-yl]-4-methylbenzene.
| Compound Name | 1-[1-bromo-2-(bromomethyl)-4-ethylsulfonylbutan-2-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 79455970 |
| Molecular Formula | C14H20Br2O2S |
| Molecular Weight | 412.19 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | 1-[1-bromo-2-(bromomethyl)-4-ethylsulfonylbutan-2-yl]-4-methylbenzene |
| SMILES | CCS(=O)(=O)CCC(CBr)(CBr)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H20Br2O2S/c1-3-19(17,18)9-8-14(10-15,11-16)13-6-4-12(2)5-7-13/h4-7H,3,8-11H2,1-2H3 |
| InChIKey | SRFQLURHTBOYNJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.19 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|