C17H26Br2 — CID 114201469
1-[1-bromo-2-(bromomethyl)-4,6-dimethylheptan-2-yl]-4-methylbenzene (PubChem CID 114201469) has the molecular formula C17H26Br2 and a molecular weight of 390.20 g/mol. Its IUPAC name is 1-[1-bromo-2-(bromomethyl)-4,6-dimethylheptan-2-yl]-4-methylbenzene.
| Compound Name | 1-[1-bromo-2-(bromomethyl)-4,6-dimethylheptan-2-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 114201469 |
| Molecular Formula | C17H26Br2 |
| Molecular Weight | 390.20 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 1-[1-bromo-2-(bromomethyl)-4,6-dimethylheptan-2-yl]-4-methylbenzene |
| SMILES | Cc1ccc(C(CBr)(CBr)CC(C)CC(C)C)cc1 |
| InChI | InChI=1S/C17H26Br2/c1-13(2)9-15(4)10-17(11-18,12-19)16-7-5-14(3)6-8-16/h5-8,13,15H,9-12H2,1-4H3 |
| InChIKey | GYLNIYGQZRRTFL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.20 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|