C13H19ClO4S — CID 79450052
2-(4-chlorophenyl)-2-(2-ethylsulfonylethyl)propane-1,3-diol (PubChem CID 79450052) has the molecular formula C13H19ClO4S and a molecular weight of 306.81 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(2-ethylsulfonylethyl)propane-1,3-diol.
| Compound Name | 2-(4-chlorophenyl)-2-(2-ethylsulfonylethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 79450052 |
| Molecular Formula | C13H19ClO4S |
| Molecular Weight | 306.81 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(2-ethylsulfonylethyl)propane-1,3-diol |
| SMILES | CCS(=O)(=O)CCC(CO)(CO)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H19ClO4S/c1-2-19(17,18)8-7-13(9-15,10-16)11-3-5-12(14)6-4-11/h3-6,15-16H,2,7-10H2,1H3 |
| InChIKey | PUNHYNLCCBQPHO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.81 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |