C14H22O4S — CID 79449954
2-(3-ethylsulfonylpropyl)-2-phenylpropane-1,3-diol (PubChem CID 79449954) has the molecular formula C14H22O4S and a molecular weight of 286.39 g/mol. Its IUPAC name is 2-(3-ethylsulfonylpropyl)-2-phenylpropane-1,3-diol.
| Compound Name | 2-(3-ethylsulfonylpropyl)-2-phenylpropane-1,3-diol |
|---|---|
| PubChem CID | 79449954 |
| Molecular Formula | C14H22O4S |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 2-(3-ethylsulfonylpropyl)-2-phenylpropane-1,3-diol |
| SMILES | CCS(=O)(=O)CCCC(CO)(CO)c1ccccc1 |
| InChI | InChI=1S/C14H22O4S/c1-2-19(17,18)10-6-9-14(11-15,12-16)13-7-4-3-5-8-13/h3-5,7-8,15-16H,2,6,9-12H2,1H3 |
| InChIKey | PIEJTDRFGPNZOH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |