C15H17ClO2S — CID 79450489
2-(4-chlorophenyl)-2-(2-thiophen-3-ylethyl)propane-1,3-diol (PubChem CID 79450489) has the molecular formula C15H17ClO2S and a molecular weight of 296.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(2-thiophen-3-ylethyl)propane-1,3-diol.
| Compound Name | 2-(4-chlorophenyl)-2-(2-thiophen-3-ylethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 79450489 |
| Molecular Formula | C15H17ClO2S |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(2-thiophen-3-ylethyl)propane-1,3-diol |
| SMILES | OCC(CO)(CCc1ccsc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClO2S/c16-14-3-1-13(2-4-14)15(10-17,11-18)7-5-12-6-8-19-9-12/h1-4,6,8-9,17-18H,5,7,10-11H2 |
| InChIKey | VGKKJZRBRUNJDI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |