C15H15NOS — CID 113318966
4-(2-hydroxy-4-thiophen-3-ylbutan-2-yl)benzonitrile (PubChem CID 113318966) has the molecular formula C15H15NOS and a molecular weight of 257.36 g/mol. Its IUPAC name is 4-(2-hydroxy-4-thiophen-3-ylbutan-2-yl)benzonitrile.
| Compound Name | 4-(2-hydroxy-4-thiophen-3-ylbutan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 113318966 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 4-(2-hydroxy-4-thiophen-3-ylbutan-2-yl)benzonitrile |
| SMILES | CC(O)(CCc1ccsc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C15H15NOS/c1-15(17,8-6-13-7-9-18-11-13)14-4-2-12(10-16)3-5-14/h2-5,7,9,11,17H,6,8H2,1H3 |
| InChIKey | ZXQWFHOVIFUUSV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |