C16H20O2S — CID 79450592
2-(3-methylphenyl)-2-(2-thiophen-3-ylethyl)propane-1,3-diol (PubChem CID 79450592) has the molecular formula C16H20O2S and a molecular weight of 276.40 g/mol. Its IUPAC name is 2-(3-methylphenyl)-2-(2-thiophen-3-ylethyl)propane-1,3-diol.
| Compound Name | 2-(3-methylphenyl)-2-(2-thiophen-3-ylethyl)propane-1,3-diol |
|---|---|
| PubChem CID | 79450592 |
| Molecular Formula | C16H20O2S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-(3-methylphenyl)-2-(2-thiophen-3-ylethyl)propane-1,3-diol |
| SMILES | Cc1cccc(C(CO)(CO)CCc2ccsc2)c1 |
| InChI | InChI=1S/C16H20O2S/c1-13-3-2-4-15(9-13)16(11-17,12-18)7-5-14-6-8-19-10-14/h2-4,6,8-10,17-18H,5,7,11-12H2,1H3 |
| InChIKey | SOWQSFNKTOMWNH-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |