C17H30ClNO — CID 142145954
(2R)-5-(4-chlorophenyl)-5-ethyl-2-methylheptan-1-ol;methanamine (PubChem CID 142145954) has the molecular formula C17H30ClNO and a molecular weight of 299.89 g/mol. Its IUPAC name is (2R)-5-(4-chlorophenyl)-5-ethyl-2-methylheptan-1-ol;methanamine.
| Compound Name | (2R)-5-(4-chlorophenyl)-5-ethyl-2-methylheptan-1-ol;methanamine |
|---|---|
| PubChem CID | 142145954 |
| Molecular Formula | C17H30ClNO |
| Molecular Weight | 299.89 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | (2R)-5-(4-chlorophenyl)-5-ethyl-2-methylheptan-1-ol;methanamine |
| SMILES | CCC(CC)(CC[C@@H](C)CO)c1ccc(Cl)cc1.CN |
| InChI | InChI=1S/C16H25ClO.CH5N/c1-4-16(5-2,11-10-13(3)12-18)14-6-8-15(17)9-7-14;1-2/h6-9,13,18H,4-5,10-12H2,1-3H3;2H2,1H3/t13-;/m1./s1 |
| InChIKey | QXUFZKIQUIMGDQ-BTQNPOSSSA-N |
| XLogP | 4.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.89 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |