C15H22Cl2O2S — CID 106734860
1-[1-chloro-2-(chloromethyl)-4-propylsulfonylbutan-2-yl]-4-methylbenzene (PubChem CID 106734860) has the molecular formula C15H22Cl2O2S and a molecular weight of 337.31 g/mol. Its IUPAC name is 1-[1-chloro-2-(chloromethyl)-4-propylsulfonylbutan-2-yl]-4-methylbenzene.
| Compound Name | 1-[1-chloro-2-(chloromethyl)-4-propylsulfonylbutan-2-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 106734860 |
| Molecular Formula | C15H22Cl2O2S |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 1-[1-chloro-2-(chloromethyl)-4-propylsulfonylbutan-2-yl]-4-methylbenzene |
| SMILES | CCCS(=O)(=O)CCC(CCl)(CCl)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H22Cl2O2S/c1-3-9-20(18,19)10-8-15(11-16,12-17)14-6-4-13(2)5-7-14/h4-7H,3,8-12H2,1-2H3 |
| InChIKey | LCXLPZPMRNKYBV-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|