C11H22Cl2O2S — CID 106734849
3,3-bis(chloromethyl)-1-propylsulfonylhexane (PubChem CID 106734849) has the molecular formula C11H22Cl2O2S and a molecular weight of 289.27 g/mol. Its IUPAC name is 3,3-bis(chloromethyl)-1-propylsulfonylhexane.
| Compound Name | 3,3-bis(chloromethyl)-1-propylsulfonylhexane |
|---|---|
| PubChem CID | 106734849 |
| Molecular Formula | C11H22Cl2O2S |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 3,3-bis(chloromethyl)-1-propylsulfonylhexane |
| SMILES | CCCC(CCl)(CCl)CCS(=O)(=O)CCC |
| InChI | InChI=1S/C11H22Cl2O2S/c1-3-5-11(9-12,10-13)6-8-16(14,15)7-4-2/h3-10H2,1-2H3 |
| InChIKey | ISNRUIUHNGBLGU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|