C10H20Br2O2S — CID 106734917
3,3-bis(bromomethyl)-1-propylsulfonylpentane (PubChem CID 106734917) has the molecular formula C10H20Br2O2S and a molecular weight of 364.14 g/mol. Its IUPAC name is 3,3-bis(bromomethyl)-1-propylsulfonylpentane.
| Compound Name | 3,3-bis(bromomethyl)-1-propylsulfonylpentane |
|---|---|
| PubChem CID | 106734917 |
| Molecular Formula | C10H20Br2O2S |
| Molecular Weight | 364.14 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | 3,3-bis(bromomethyl)-1-propylsulfonylpentane |
| SMILES | CCCS(=O)(=O)CCC(CC)(CBr)CBr |
| InChI | InChI=1S/C10H20Br2O2S/c1-3-6-15(13,14)7-5-10(4-2,8-11)9-12/h3-9H2,1-2H3 |
| InChIKey | PMFRFXMYXGJPFW-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.14 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|