C13H29NO2S — CID 62724247
2,2-diethyl-4-ethylsulfonyl-N-propan-2-ylbutan-1-amine (PubChem CID 62724247) has the molecular formula C13H29NO2S and a molecular weight of 263.45 g/mol. Its IUPAC name is 2,2-diethyl-4-ethylsulfonyl-N-propan-2-ylbutan-1-amine.
| Compound Name | 2,2-diethyl-4-ethylsulfonyl-N-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 62724247 |
| Molecular Formula | C13H29NO2S |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | 2,2-diethyl-4-ethylsulfonyl-N-propan-2-ylbutan-1-amine |
| SMILES | CCC(CC)(CCS(=O)(=O)CC)CNC(C)C |
| InChI | InChI=1S/C13H29NO2S/c1-6-13(7-2,11-14-12(4)5)9-10-17(15,16)8-3/h12,14H,6-11H2,1-5H3 |
| InChIKey | FDOUYDLKAHMHGJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |