C17H37N — CID 82930458
2-butyl-2,4-diethyl-N-propan-2-ylhexan-1-amine (PubChem CID 82930458) has the molecular formula C17H37N and a molecular weight of 255.49 g/mol. Its IUPAC name is 2-butyl-2,4-diethyl-N-propan-2-ylhexan-1-amine.
| Compound Name | 2-butyl-2,4-diethyl-N-propan-2-ylhexan-1-amine |
|---|---|
| PubChem CID | 82930458 |
| Molecular Formula | C17H37N |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 255.29 |
| IUPAC Name | 2-butyl-2,4-diethyl-N-propan-2-ylhexan-1-amine |
| SMILES | CCCCC(CC)(CNC(C)C)CC(CC)CC |
| InChI | InChI=1S/C17H37N/c1-7-11-12-17(10-4,14-18-15(5)6)13-16(8-2)9-3/h15-16,18H,7-14H2,1-6H3 |
| InChIKey | NQQTYCVQXAAMRQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |