C16H35N — CID 55220449
2-ethyl-N,2-bis(2-methylpropyl)hexan-1-amine (PubChem CID 55220449) has the molecular formula C16H35N and a molecular weight of 241.46 g/mol. Its IUPAC name is 2-ethyl-N,2-bis(2-methylpropyl)hexan-1-amine.
| Compound Name | 2-ethyl-N,2-bis(2-methylpropyl)hexan-1-amine |
|---|---|
| PubChem CID | 55220449 |
| Molecular Formula | C16H35N |
| Molecular Weight | 241.46 g/mol |
| Exact Mass | 241.28 |
| IUPAC Name | 2-ethyl-N,2-bis(2-methylpropyl)hexan-1-amine |
| SMILES | CCCCC(CC)(CNCC(C)C)CC(C)C |
| InChI | InChI=1S/C16H35N/c1-7-9-10-16(8-2,11-14(3)4)13-17-12-15(5)6/h14-15,17H,7-13H2,1-6H3 |
| InChIKey | BJHKVQLTTJIPKH-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |