C18H39N — CID 82930649
2-butyl-2,4-diethyl-N-(2-methylpropyl)hexan-1-amine (PubChem CID 82930649) has the molecular formula C18H39N and a molecular weight of 269.52 g/mol. Its IUPAC name is 2-butyl-2,4-diethyl-N-(2-methylpropyl)hexan-1-amine.
| Compound Name | 2-butyl-2,4-diethyl-N-(2-methylpropyl)hexan-1-amine |
|---|---|
| PubChem CID | 82930649 |
| Molecular Formula | C18H39N |
| Molecular Weight | 269.52 g/mol |
| Exact Mass | 269.31 |
| IUPAC Name | 2-butyl-2,4-diethyl-N-(2-methylpropyl)hexan-1-amine |
| SMILES | CCCCC(CC)(CNCC(C)C)CC(CC)CC |
| InChI | InChI=1S/C18H39N/c1-7-11-12-18(10-4,13-17(8-2)9-3)15-19-14-16(5)6/h16-17,19H,7-15H2,1-6H3 |
| InChIKey | VJYGFZVUZXVVHP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |