C23H48 — CID 174469307
6,6-bis(2-ethylbutyl)undecane (PubChem CID 174469307) has the molecular formula C23H48 and a molecular weight of 324.64 g/mol. Its IUPAC name is 6,6-bis(2-ethylbutyl)undecane.
| Compound Name | 6,6-bis(2-ethylbutyl)undecane |
|---|---|
| PubChem CID | 174469307 |
| Molecular Formula | C23H48 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 324.38 |
| IUPAC Name | 6,6-bis(2-ethylbutyl)undecane |
| SMILES | CCCCCC(CCCCC)(CC(CC)CC)CC(CC)CC |
| InChI | InChI=1S/C23H48/c1-7-13-15-17-23(18-16-14-8-2,19-21(9-3)10-4)20-22(11-5)12-6/h21-22H,7-20H2,1-6H3 |
| InChIKey | GEBSJIYUONYOBP-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|