C20H43N — CID 63509481
N-tert-butyl-2-butyl-2,4-diethyloctan-1-amine (PubChem CID 63509481) has the molecular formula C20H43N and a molecular weight of 297.57 g/mol. Its IUPAC name is N-tert-butyl-2-butyl-2,4-diethyloctan-1-amine.
| Compound Name | N-tert-butyl-2-butyl-2,4-diethyloctan-1-amine |
|---|---|
| PubChem CID | 63509481 |
| Molecular Formula | C20H43N |
| Molecular Weight | 297.57 g/mol |
| Exact Mass | 297.34 |
| IUPAC Name | N-tert-butyl-2-butyl-2,4-diethyloctan-1-amine |
| SMILES | CCCCC(CC)CC(CC)(CCCC)CNC(C)(C)C |
| InChI | InChI=1S/C20H43N/c1-8-12-14-18(10-3)16-20(11-4,15-13-9-2)17-21-19(5,6)7/h18,21H,8-17H2,1-7H3 |
| InChIKey | HYGVJCPGRNHZDG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.57 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |