C14H29NO2S — CID 106729943
N-(2,2-diethyl-4-propylsulfonylbutyl)cyclopropanamine (PubChem CID 106729943) has the molecular formula C14H29NO2S and a molecular weight of 275.46 g/mol. Its IUPAC name is N-(2,2-diethyl-4-propylsulfonylbutyl)cyclopropanamine.
| Compound Name | N-(2,2-diethyl-4-propylsulfonylbutyl)cyclopropanamine |
|---|---|
| PubChem CID | 106729943 |
| Molecular Formula | C14H29NO2S |
| Molecular Weight | 275.46 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N-(2,2-diethyl-4-propylsulfonylbutyl)cyclopropanamine |
| SMILES | CCCS(=O)(=O)CCC(CC)(CC)CNC1CC1 |
| InChI | InChI=1S/C14H29NO2S/c1-4-10-18(16,17)11-9-14(5-2,6-3)12-15-13-7-8-13/h13,15H,4-12H2,1-3H3 |
| InChIKey | SHANGVZAWXNIOR-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |