C13H17BrCl2O2S — CID 79453506
1-bromo-4-[1-chloro-2-(chloromethyl)-5-methylsulfonylpentan-2-yl]benzene (PubChem CID 79453506) has the molecular formula C13H17BrCl2O2S and a molecular weight of 388.15 g/mol. Its IUPAC name is 1-bromo-4-[1-chloro-2-(chloromethyl)-5-methylsulfonylpentan-2-yl]benzene.
| Compound Name | 1-bromo-4-[1-chloro-2-(chloromethyl)-5-methylsulfonylpentan-2-yl]benzene |
|---|---|
| PubChem CID | 79453506 |
| Molecular Formula | C13H17BrCl2O2S |
| Molecular Weight | 388.15 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | 1-bromo-4-[1-chloro-2-(chloromethyl)-5-methylsulfonylpentan-2-yl]benzene |
| SMILES | CS(=O)(=O)CCCC(CCl)(CCl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H17BrCl2O2S/c1-19(17,18)8-2-7-13(9-15,10-16)11-3-5-12(14)6-4-11/h3-6H,2,7-10H2,1H3 |
| InChIKey | KSJBFLIKURWQNO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.15 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|