C12H15FO3S — CID 4304537
1-cyclopropyl-1-(4-fluorophenyl)-2-methylsulfonylethanol (PubChem CID 4304537) has the molecular formula C12H15FO3S and a molecular weight of 258.31 g/mol. Its IUPAC name is 1-cyclopropyl-1-(4-fluorophenyl)-2-methylsulfonylethanol.
| Compound Name | 1-cyclopropyl-1-(4-fluorophenyl)-2-methylsulfonylethanol |
|---|---|
| PubChem CID | 4304537 |
| Molecular Formula | C12H15FO3S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-cyclopropyl-1-(4-fluorophenyl)-2-methylsulfonylethanol |
| SMILES | CS(=O)(=O)CC(O)(c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C12H15FO3S/c1-17(15,16)8-12(14,9-2-3-9)10-4-6-11(13)7-5-10/h4-7,9,14H,2-3,8H2,1H3 |
| InChIKey | WBNXAAGOENILNR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |