C13H17FO — CID 107128071
1-cyclopropyl-1-(3-fluoro-4-methylphenyl)propan-1-ol (PubChem CID 107128071) has the molecular formula C13H17FO and a molecular weight of 208.28 g/mol. Its IUPAC name is 1-cyclopropyl-1-(3-fluoro-4-methylphenyl)propan-1-ol.
| Compound Name | 1-cyclopropyl-1-(3-fluoro-4-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 107128071 |
| Molecular Formula | C13H17FO |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 1-cyclopropyl-1-(3-fluoro-4-methylphenyl)propan-1-ol |
| SMILES | CCC(O)(c1ccc(C)c(F)c1)C1CC1 |
| InChI | InChI=1S/C13H17FO/c1-3-13(15,10-6-7-10)11-5-4-9(2)12(14)8-11/h4-5,8,10,15H,3,6-7H2,1-2H3 |
| InChIKey | PRDRUOWMOCLYGH-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |