C12H13F4NO — CID 107287772
2-amino-1-cyclopropyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanol (PubChem CID 107287772) has the molecular formula C12H13F4NO and a molecular weight of 263.23 g/mol. Its IUPAC name is 2-amino-1-cyclopropyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanol.
| Compound Name | 2-amino-1-cyclopropyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanol |
|---|---|
| PubChem CID | 107287772 |
| Molecular Formula | C12H13F4NO |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 2-amino-1-cyclopropyl-1-[3-fluoro-4-(trifluoromethyl)phenyl]ethanol |
| SMILES | NCC(O)(c1ccc(C(F)(F)F)c(F)c1)C1CC1 |
| InChI | InChI=1S/C12H13F4NO/c13-10-5-8(3-4-9(10)12(14,15)16)11(18,6-17)7-1-2-7/h3-5,7,18H,1-2,6,17H2 |
| InChIKey | NLKDRWNACRVJCZ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |