C13H18FNO — CID 82114809
1-cyclopropyl-2-(dimethylamino)-1-(4-fluorophenyl)ethanol (PubChem CID 82114809) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is 1-cyclopropyl-2-(dimethylamino)-1-(4-fluorophenyl)ethanol.
| Compound Name | 1-cyclopropyl-2-(dimethylamino)-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 82114809 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-cyclopropyl-2-(dimethylamino)-1-(4-fluorophenyl)ethanol |
| SMILES | CN(C)CC(O)(c1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C13H18FNO/c1-15(2)9-13(16,10-3-4-10)11-5-7-12(14)8-6-11/h5-8,10,16H,3-4,9H2,1-2H3 |
| InChIKey | NZNHDHZPQMILTP-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |