C13H17FO — CID 64919767
2-cyclopropyl-1-(4-fluorophenyl)butan-2-ol (PubChem CID 64919767) has the molecular formula C13H17FO and a molecular weight of 208.28 g/mol. Its IUPAC name is 2-cyclopropyl-1-(4-fluorophenyl)butan-2-ol.
| Compound Name | 2-cyclopropyl-1-(4-fluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 64919767 |
| Molecular Formula | C13H17FO |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2-cyclopropyl-1-(4-fluorophenyl)butan-2-ol |
| SMILES | CCC(O)(Cc1ccc(F)cc1)C1CC1 |
| InChI | InChI=1S/C13H17FO/c1-2-13(15,11-5-6-11)9-10-3-7-12(14)8-4-10/h3-4,7-8,11,15H,2,5-6,9H2,1H3 |
| InChIKey | WINDJKMWLIKJFB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |