C14H28N2O2S — CID 106733202
5-cyclopropyl-2,5-dimethyl-1-(2-propylsulfonylethyl)piperazine (PubChem CID 106733202) has the molecular formula C14H28N2O2S and a molecular weight of 288.46 g/mol. Its IUPAC name is 5-cyclopropyl-2,5-dimethyl-1-(2-propylsulfonylethyl)piperazine.
| Compound Name | 5-cyclopropyl-2,5-dimethyl-1-(2-propylsulfonylethyl)piperazine |
|---|---|
| PubChem CID | 106733202 |
| Molecular Formula | C14H28N2O2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 5-cyclopropyl-2,5-dimethyl-1-(2-propylsulfonylethyl)piperazine |
| SMILES | CCCS(=O)(=O)CCN1CC(C)(C2CC2)NCC1C |
| InChI | InChI=1S/C14H28N2O2S/c1-4-8-19(17,18)9-7-16-11-14(3,13-5-6-13)15-10-12(16)2/h12-13,15H,4-11H2,1-3H3 |
| InChIKey | QKNOKMNBABJQGM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |