C16H32N2O2S — CID 106733248
2-cyclopropyl-5,5-diethyl-1-(2-propylsulfonylethyl)piperazine (PubChem CID 106733248) has the molecular formula C16H32N2O2S and a molecular weight of 316.51 g/mol. Its IUPAC name is 2-cyclopropyl-5,5-diethyl-1-(2-propylsulfonylethyl)piperazine.
| Compound Name | 2-cyclopropyl-5,5-diethyl-1-(2-propylsulfonylethyl)piperazine |
|---|---|
| PubChem CID | 106733248 |
| Molecular Formula | C16H32N2O2S |
| Molecular Weight | 316.51 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 2-cyclopropyl-5,5-diethyl-1-(2-propylsulfonylethyl)piperazine |
| SMILES | CCCS(=O)(=O)CCN1CC(CC)(CC)NCC1C1CC1 |
| InChI | InChI=1S/C16H32N2O2S/c1-4-10-21(19,20)11-9-18-13-16(5-2,6-3)17-12-15(18)14-7-8-14/h14-15,17H,4-13H2,1-3H3 |
| InChIKey | BKBFGBPULDRPRT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.51 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |