C13H24N2O4S — CID 106733709
1-(2-tert-butylsulfonylethyl)-3-propylpiperazine-2,5-dione (PubChem CID 106733709) has the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)-3-propylpiperazine-2,5-dione.
| Compound Name | 1-(2-tert-butylsulfonylethyl)-3-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 106733709 |
| Molecular Formula | C13H24N2O4S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)-3-propylpiperazine-2,5-dione |
| SMILES | CCCC1NC(=O)CN(CCS(=O)(=O)C(C)(C)C)C1=O |
| InChI | InChI=1S/C13H24N2O4S/c1-5-6-10-12(17)15(9-11(16)14-10)7-8-20(18,19)13(2,3)4/h10H,5-9H2,1-4H3,(H,14,16) |
| InChIKey | QZXQHUJASCAXPF-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |