C13H20N4O2 — CID 64878857
1-(3-imidazol-1-ylpropyl)-3-propylpiperazine-2,5-dione (PubChem CID 64878857) has the molecular formula C13H20N4O2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-3-propylpiperazine-2,5-dione.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-3-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 64878857 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-3-propylpiperazine-2,5-dione |
| SMILES | CCCC1NC(=O)CN(CCCn2ccnc2)C1=O |
| InChI | InChI=1S/C13H20N4O2/c1-2-4-11-13(19)17(9-12(18)15-11)7-3-6-16-8-5-14-10-16/h5,8,10-11H,2-4,6-7,9H2,1H3,(H,15,18) |
| InChIKey | MKXKXYZRKUSBGW-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |