C11H24O3S — CID 106734425
3,3-dimethyl-2-(2-propylsulfonylethyl)butan-1-ol (PubChem CID 106734425) has the molecular formula C11H24O3S and a molecular weight of 236.38 g/mol. Its IUPAC name is 3,3-dimethyl-2-(2-propylsulfonylethyl)butan-1-ol.
| Compound Name | 3,3-dimethyl-2-(2-propylsulfonylethyl)butan-1-ol |
|---|---|
| PubChem CID | 106734425 |
| Molecular Formula | C11H24O3S |
| Molecular Weight | 236.38 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 3,3-dimethyl-2-(2-propylsulfonylethyl)butan-1-ol |
| SMILES | CCCS(=O)(=O)CCC(CO)C(C)(C)C |
| InChI | InChI=1S/C11H24O3S/c1-5-7-15(13,14)8-6-10(9-12)11(2,3)4/h10,12H,5-9H2,1-4H3 |
| InChIKey | ADRRSEWKLSNKFC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.38 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |