C9H20O3S — CID 83139457
3,3-dimethyl-2-(2-methylsulfonylethyl)butan-1-ol (PubChem CID 83139457) has the molecular formula C9H20O3S and a molecular weight of 208.32 g/mol. Its IUPAC name is 3,3-dimethyl-2-(2-methylsulfonylethyl)butan-1-ol.
| Compound Name | 3,3-dimethyl-2-(2-methylsulfonylethyl)butan-1-ol |
|---|---|
| PubChem CID | 83139457 |
| Molecular Formula | C9H20O3S |
| Molecular Weight | 208.32 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 3,3-dimethyl-2-(2-methylsulfonylethyl)butan-1-ol |
| SMILES | CC(C)(C)C(CO)CCS(C)(=O)=O |
| InChI | InChI=1S/C9H20O3S/c1-9(2,3)8(7-10)5-6-13(4,11)12/h8,10H,5-7H2,1-4H3 |
| InChIKey | GZWDHOQQOJLXRH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |