C13H28O4S2 — CID 89358677
4-(3-hydroxypropylsulfanyl)-2,4-dimethyl-2-propan-2-ylpentane-1-sulfonic acid (PubChem CID 89358677) has the molecular formula C13H28O4S2 and a molecular weight of 312.50 g/mol. Its IUPAC name is 4-(3-hydroxypropylsulfanyl)-2,4-dimethyl-2-propan-2-ylpentane-1-sulfonic acid.
| Compound Name | 4-(3-hydroxypropylsulfanyl)-2,4-dimethyl-2-propan-2-ylpentane-1-sulfonic acid |
|---|---|
| PubChem CID | 89358677 |
| Molecular Formula | C13H28O4S2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.14 |
| IUPAC Name | 4-(3-hydroxypropylsulfanyl)-2,4-dimethyl-2-propan-2-ylpentane-1-sulfonic acid |
| SMILES | CC(C)C(C)(CC(C)(C)SCCCO)CS(=O)(=O)O |
| InChI | InChI=1S/C13H28O4S2/c1-11(2)13(5,10-19(15,16)17)9-12(3,4)18-8-6-7-14/h11,14H,6-10H2,1-5H3,(H,15,16,17) |
| InChIKey | ZTIYYXSNPWKTIE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|